1a. Draw the structures of the following organic compounds i. 2 Ethyl-1 -pentene ii. 2 Methyl-2-propanol iii. Diethyl ether iv. 4 Methyl pentanal

i. 2 Ethyl-1-pentene: This compound has a five-carbon chain (pentene) with an ethyl group attached to the second carbon atom. The structure can be represented as follows:<br /><br />CH2=CH-CH(CH2CH3)-CH2-CH3<br /><br />ii. 2 Methyl-2-propanol: This compound has a three-carbon chain (propanol) with a methyl group attached to the second carbon atom. The structure can be represented as follows:<br /><br />CH3-C(OH)-CH2-CH3<br /><br />iii. Diethyl ether: This compound consists of two ethyl groups attached to an oxygen atom. The structure can be represented as follows:<br /><br />CH3CH2-O-CH2CH3<br /><br />iv. 4 Methyl pentanal: This compound has a five-carbon chain (pentanal) with a methyl group attached to the fourth carbon atom. The structure can be represented as follows:<br /><br />CH3-CH2-CH2-CH(CH3)-CHO